C15H19F3N4O6 — CID 155421320
N-[3-[1-[2-(aminomethoxy)-4-hydroxy-3-methoxybutyl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide (PubChem CID 155421320) has the molecular formula C15H19F3N4O6 and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[3-[1-[2-(aminomethoxy)-4-hydroxy-3-methoxybutyl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[1-[2-(aminomethoxy)-4-hydroxy-3-methoxybutyl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 155421320 |
| Molecular Formula | C15H19F3N4O6 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[3-[1-[2-(aminomethoxy)-4-hydroxy-3-methoxybutyl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]-2,2,2-trifluoroacetamide |
| SMILES | COC(CO)C(Cn1cc(C#CCNC(=O)C(F)(F)F)c(=O)[nH]c1=O)OCN |
| InChI | InChI=1S/C15H19F3N4O6/c1-27-11(7-23)10(28-8-19)6-22-5-9(12(24)21-14(22)26)3-2-4-20-13(25)15(16,17)18/h5,10-11,23H,4,6-8,19H2,1H3,(H,20,25)(H,21,24,26) |
| InChIKey | TXQJCLRWMPNETD-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|