C14H21N3O3 — CID 166551975
ethane;2-methyl-N-[3-(1-methyl-2,4-dioxopyrimidin-5-yl)prop-2-ynyl]propanamide (PubChem CID 166551975) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is ethane;2-methyl-N-[3-(1-methyl-2,4-dioxopyrimidin-5-yl)prop-2-ynyl]propanamide.
| Compound Name | ethane;2-methyl-N-[3-(1-methyl-2,4-dioxopyrimidin-5-yl)prop-2-ynyl]propanamide |
|---|---|
| PubChem CID | 166551975 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethane;2-methyl-N-[3-(1-methyl-2,4-dioxopyrimidin-5-yl)prop-2-ynyl]propanamide |
| SMILES | CC.CC(C)C(=O)NCC#Cc1cn(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H15N3O3.C2H6/c1-8(2)10(16)13-6-4-5-9-7-15(3)12(18)14-11(9)17;1-2/h7-8H,6H2,1-3H3,(H,13,16)(H,14,17,18);1-2H3 |
| InChIKey | ULAXNMQQISWCOR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|