C10H12N2O4 — CID 67951281
5-(4,5-dihydroxypent-1-ynyl)-1-methylpyrimidine-2,4-dione (PubChem CID 67951281) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 5-(4,5-dihydroxypent-1-ynyl)-1-methylpyrimidine-2,4-dione.
| Compound Name | 5-(4,5-dihydroxypent-1-ynyl)-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67951281 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 5-(4,5-dihydroxypent-1-ynyl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(C#CCC(O)CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O4/c1-12-5-7(9(15)11-10(12)16)3-2-4-8(14)6-13/h5,8,13-14H,4,6H2,1H3,(H,11,15,16) |
| InChIKey | FRDJYRBXPHEZFY-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|