C10H12N2O3 — CID 164872342
5-(3-hydroxyprop-1-ynyl)-1-propan-2-ylpyrimidine-2,4-dione (PubChem CID 164872342) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-1-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-1-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 164872342 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-1-propan-2-ylpyrimidine-2,4-dione |
| SMILES | CC(C)n1cc(C#CCO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O3/c1-7(2)12-6-8(4-3-5-13)9(14)11-10(12)15/h6-7,13H,5H2,1-2H3,(H,11,14,15) |
| InChIKey | OOPUTXBNOKHYBT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|