C17H29NS — CID 155426911
4-[butan-2-yl(methyl)amino]-3,3-dimethyl-4-phenylbutane-1-thiol (PubChem CID 155426911) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 4-[butan-2-yl(methyl)amino]-3,3-dimethyl-4-phenylbutane-1-thiol.
| Compound Name | 4-[butan-2-yl(methyl)amino]-3,3-dimethyl-4-phenylbutane-1-thiol |
|---|---|
| PubChem CID | 155426911 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 4-[butan-2-yl(methyl)amino]-3,3-dimethyl-4-phenylbutane-1-thiol |
| SMILES | CCC(C)N(C)C(c1ccccc1)C(C)(C)CCS |
| InChI | InChI=1S/C17H29NS/c1-6-14(2)18(5)16(17(3,4)12-13-19)15-10-8-7-9-11-15/h7-11,14,16,19H,6,12-13H2,1-5H3 |
| InChIKey | LFYZKKPPPXCKLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|