C22H33N3O4S — CID 155429027
ethyl (1Z)-N-[[(1S)-1-phenylethoxy]carbonylamino]-4-(propan-2-yloxycarbonylamino)cyclohexane-1-carboximidothioate (PubChem CID 155429027) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is ethyl (1Z)-N-[[(1S)-1-phenylethoxy]carbonylamino]-4-(propan-2-yloxycarbonylamino)cyclohexane-1-carboximidothioate.
| Compound Name | ethyl (1Z)-N-[[(1S)-1-phenylethoxy]carbonylamino]-4-(propan-2-yloxycarbonylamino)cyclohexane-1-carboximidothioate |
|---|---|
| PubChem CID | 155429027 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | ethyl (1Z)-N-[[(1S)-1-phenylethoxy]carbonylamino]-4-(propan-2-yloxycarbonylamino)cyclohexane-1-carboximidothioate |
| SMILES | CCS/C(=N\NC(=O)O[C@@H](C)c1ccccc1)C1CCC(NC(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C22H33N3O4S/c1-5-30-20(18-11-13-19(14-12-18)23-21(26)28-15(2)3)24-25-22(27)29-16(4)17-9-7-6-8-10-17/h6-10,15-16,18-19H,5,11-14H2,1-4H3,(H,23,26)(H,25,27)/b24-20-/t16-,18?,19?/m0/s1 |
| InChIKey | XAYPGJJBKYASCE-HAFVHYJESA-N |
| XLogP | 5.23 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|