C25H41N5O12 — CID 155433257
(2S,3S,4S)-4-acetyloxy-3-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-1,2-dicarboxylic acid (PubChem CID 155433257) has the molecular formula C25H41N5O12 and a molecular weight of 603.63 g/mol. Its IUPAC name is (2S,3S,4S)-4-acetyloxy-3-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S,3S,4S)-4-acetyloxy-3-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 155433257 |
| Molecular Formula | C25H41N5O12 |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | (2S,3S,4S)-4-acetyloxy-3-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-1,2-dicarboxylic acid |
| SMILES | COC(=O)CN1CCN(CC(=O)OC)CCN([C@@H]2[C@@H](OC(C)=O)CN(C(=O)O)[C@@H]2C(=O)O)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C25H41N5O12/c1-17(31)42-18-13-30(25(37)38)23(24(35)36)22(18)29-11-9-27(15-20(33)40-3)7-5-26(14-19(32)39-2)6-8-28(10-12-29)16-21(34)41-4/h18,22-23H,5-16H2,1-4H3,(H,35,36)(H,37,38)/t18-,22+,23-/m0/s1 |
| InChIKey | HLLNFEZJLWIKTA-NMNUPHIUSA-N |
| XLogP | -2.53 |
| TPSA | 196.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|