C32H59N5O8 — CID 175913829
tert-butyl 2-[7-[(3R,4R)-4-acetyloxypyrrolidin-3-yl]-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 175913829) has the molecular formula C32H59N5O8 and a molecular weight of 641.85 g/mol. Its IUPAC name is tert-butyl 2-[7-[(3R,4R)-4-acetyloxypyrrolidin-3-yl]-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[7-[(3R,4R)-4-acetyloxypyrrolidin-3-yl]-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 175913829 |
| Molecular Formula | C32H59N5O8 |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.44 |
| IUPAC Name | tert-butyl 2-[7-[(3R,4R)-4-acetyloxypyrrolidin-3-yl]-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(=O)O[C@@H]1CNC[C@H]1N1CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H59N5O8/c1-24(38)42-26-20-33-19-25(26)37-17-15-35(22-28(40)44-31(5,6)7)13-11-34(21-27(39)43-30(2,3)4)12-14-36(16-18-37)23-29(41)45-32(8,9)10/h25-26,33H,11-23H2,1-10H3/t25-,26-/m1/s1 |
| InChIKey | JTZBUIDOQFUHPU-CLJLJLNGSA-N |
| XLogP | 1.14 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|