C31H57N5O8 — CID 175727288
3-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid (PubChem CID 175727288) has the molecular formula C31H57N5O8 and a molecular weight of 627.82 g/mol. Its IUPAC name is 3-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | 3-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175727288 |
| Molecular Formula | C31H57N5O8 |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 627.42 |
| IUPAC Name | 3-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(C2CCNC2C(=O)O)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H57N5O8/c1-29(2,3)42-24(37)20-33-12-14-34(21-25(38)43-30(4,5)6)16-18-36(23-10-11-32-27(23)28(40)41)19-17-35(15-13-33)22-26(39)44-31(7,8)9/h23,27,32H,10-22H2,1-9H3,(H,40,41) |
| InChIKey | DHKMURDNADWZNP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|