C33H59N5O10 — CID 155433238
(2S,3R,4R)-3-acetyloxy-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid (PubChem CID 155433238) has the molecular formula C33H59N5O10 and a molecular weight of 685.86 g/mol. Its IUPAC name is (2S,3R,4R)-3-acetyloxy-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-3-acetyloxy-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155433238 |
| Molecular Formula | C33H59N5O10 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.43 |
| IUPAC Name | (2S,3R,4R)-3-acetyloxy-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)O[C@@H]1[C@@H](C(=O)O)NC[C@H]1N1CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H59N5O10/c1-23(39)45-29-24(19-34-28(29)30(43)44)38-17-15-36(21-26(41)47-32(5,6)7)13-11-35(20-25(40)46-31(2,3)4)12-14-37(16-18-38)22-27(42)48-33(8,9)10/h24,28-29,34H,11-22H2,1-10H3,(H,43,44)/t24-,28+,29+/m1/s1 |
| InChIKey | GCRSLNPBVZXSFO-MHZHKKNFSA-N |
| XLogP | 0.59 |
| TPSA | 167.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|