C13H17ClF2N2O — CID 155435061
N-[(2R)-1-chloro-2-methylhexan-2-yl]-3,5-difluoropyridine-2-carboxamide (PubChem CID 155435061) has the molecular formula C13H17ClF2N2O and a molecular weight of 290.74 g/mol. Its IUPAC name is N-[(2R)-1-chloro-2-methylhexan-2-yl]-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-[(2R)-1-chloro-2-methylhexan-2-yl]-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 155435061 |
| Molecular Formula | C13H17ClF2N2O |
| Molecular Weight | 290.74 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | N-[(2R)-1-chloro-2-methylhexan-2-yl]-3,5-difluoropyridine-2-carboxamide |
| SMILES | CCCC[C@](C)(CCl)NC(=O)c1ncc(F)cc1F |
| InChI | InChI=1S/C13H17ClF2N2O/c1-3-4-5-13(2,8-14)18-12(19)11-10(16)6-9(15)7-17-11/h6-7H,3-5,8H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | ZBAOVVVTYODAHT-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.74 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|