C11H12F2N2O3S — CID 91764713
N-(1,1-dioxothian-4-yl)-3,5-difluoropyridine-2-carboxamide (PubChem CID 91764713) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-3,5-difluoropyridine-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-3,5-difluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 91764713 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-3,5-difluoropyridine-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)c1ncc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O3S/c12-7-5-9(13)10(14-6-7)11(16)15-8-1-3-19(17,18)4-2-8/h5-6,8H,1-4H2,(H,15,16) |
| InChIKey | KORYWCKUXSHQIB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |