C28H40FNO2 — CID 155438568
N-[[(1S,4aS,4bR,6aR,8R,10aS,10bR,12aS)-8-hydroxy-8,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]methyl]-2-fluorobenzamide (PubChem CID 155438568) has the molecular formula C28H40FNO2 and a molecular weight of 441.63 g/mol. Its IUPAC name is N-[[(1S,4aS,4bR,6aR,8R,10aS,10bR,12aS)-8-hydroxy-8,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]methyl]-2-fluorobenzamide.
| Compound Name | N-[[(1S,4aS,4bR,6aR,8R,10aS,10bR,12aS)-8-hydroxy-8,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 155438568 |
| Molecular Formula | C28H40FNO2 |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | N-[[(1S,4aS,4bR,6aR,8R,10aS,10bR,12aS)-8-hydroxy-8,12a-dimethyl-1,2,3,4,4a,4b,5,6,6a,7,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]methyl]-2-fluorobenzamide |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](CNC(=O)c4ccccc4F)CCC[C@@H]32)C1 |
| InChI | InChI=1S/C28H40FNO2/c1-27(32)14-12-20-18(16-27)10-11-22-21(20)13-15-28(2)19(6-5-8-24(22)28)17-30-26(31)23-7-3-4-9-25(23)29/h3-4,7,9,18-22,24,32H,5-6,8,10-17H2,1-2H3,(H,30,31)/t18-,19-,20+,21-,22-,24+,27-,28-/m1/s1 |
| InChIKey | ROOQTWJMABHDLP-XIDGNBBVSA-N |
| XLogP | 5.97 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |