C21H27FN4O2 — CID 155438951
(2R,6R)-4-(2-fluoro-4-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]-2,6-dimethylpiperazine-1-carboxamide (PubChem CID 155438951) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is (2R,6R)-4-(2-fluoro-4-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]-2,6-dimethylpiperazine-1-carboxamide.
| Compound Name | (2R,6R)-4-(2-fluoro-4-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]-2,6-dimethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 155438951 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R,6R)-4-(2-fluoro-4-pyridinyl)-N-[1-(3-methoxyphenyl)ethyl]-2,6-dimethylpiperazine-1-carboxamide |
| SMILES | COc1cccc(C(C)NC(=O)N2[C@H](C)CN(c3ccnc(F)c3)C[C@H]2C)c1 |
| InChI | InChI=1S/C21H27FN4O2/c1-14-12-25(18-8-9-23-20(22)11-18)13-15(2)26(14)21(27)24-16(3)17-6-5-7-19(10-17)28-4/h5-11,14-16H,12-13H2,1-4H3,(H,24,27)/t14-,15-,16?/m1/s1 |
| InChIKey | JNEHVMMGEFOCOY-YGFGXBMJSA-N |
| XLogP | 3.60 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|