C19H21F3N4O2 — CID 166049417
N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide (PubChem CID 166049417) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 166049417 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-[(1R)-1-[3-(difluoromethoxy)phenyl]ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide |
| SMILES | C[C@@H](NC(=O)N1CCN(c2ccnc(F)c2)CC1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-13(14-3-2-4-16(11-14)28-18(21)22)24-19(27)26-9-7-25(8-10-26)15-5-6-23-17(20)12-15/h2-6,11-13,18H,7-10H2,1H3,(H,24,27)/t13-/m1/s1 |
| InChIKey | NTZKSIILMXIIGO-CYBMUJFWSA-N |
| XLogP | 3.41 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|