C19H22ClFN4O2 — CID 174195184
N-[(1R)-1-(2-chloro-5-methoxyphenyl)ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide (PubChem CID 174195184) has the molecular formula C19H22ClFN4O2 and a molecular weight of 392.86 g/mol. Its IUPAC name is N-[(1R)-1-(2-chloro-5-methoxyphenyl)ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide.
| Compound Name | N-[(1R)-1-(2-chloro-5-methoxyphenyl)ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 174195184 |
| Molecular Formula | C19H22ClFN4O2 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-[(1R)-1-(2-chloro-5-methoxyphenyl)ethyl]-4-(2-fluoro-4-pyridinyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(Cl)c([C@@H](C)NC(=O)N2CCN(c3ccnc(F)c3)CC2)c1 |
| InChI | InChI=1S/C19H22ClFN4O2/c1-13(16-12-15(27-2)3-4-17(16)20)23-19(26)25-9-7-24(8-10-25)14-5-6-22-18(21)11-14/h3-6,11-13H,7-10H2,1-2H3,(H,23,26)/t13-/m1/s1 |
| InChIKey | PAWXBEDNCPQUBX-CYBMUJFWSA-N |
| XLogP | 3.48 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|