C20H28F2 — CID 155443324
4-[4-(4-ethylhex-5-enyl)cyclohexyl]-1,2-difluorobenzene (PubChem CID 155443324) has the molecular formula C20H28F2 and a molecular weight of 306.44 g/mol. Its IUPAC name is 4-[4-(4-ethylhex-5-enyl)cyclohexyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-(4-ethylhex-5-enyl)cyclohexyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 155443324 |
| Molecular Formula | C20H28F2 |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 4-[4-(4-ethylhex-5-enyl)cyclohexyl]-1,2-difluorobenzene |
| SMILES | C=CC(CC)CCCC1CCC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H28F2/c1-3-15(4-2)6-5-7-16-8-10-17(11-9-16)18-12-13-19(21)20(22)14-18/h3,12-17H,1,4-11H2,2H3 |
| InChIKey | XHVCEZLWHCCJJB-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|