C6H9O3P — CID 155444857
[(1E)-3-hydroxy-1-methoxybuta-1,3-dienyl]phosphanylformaldehyde (PubChem CID 155444857) has the molecular formula C6H9O3P and a molecular weight of 160.11 g/mol. Its IUPAC name is [(1E)-3-hydroxy-1-methoxybuta-1,3-dienyl]phosphanylformaldehyde.
| Compound Name | [(1E)-3-hydroxy-1-methoxybuta-1,3-dienyl]phosphanylformaldehyde |
|---|---|
| PubChem CID | 155444857 |
| Molecular Formula | C6H9O3P |
| Molecular Weight | 160.11 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | [(1E)-3-hydroxy-1-methoxybuta-1,3-dienyl]phosphanylformaldehyde |
| SMILES | C=C(O)/C=C(\OC)PC=O |
| InChI | InChI=1S/C6H9O3P/c1-5(8)3-6(9-2)10-4-7/h3-4,8,10H,1H2,2H3/b6-3+ |
| InChIKey | FKPBWUMCBDKOLD-ZZXKWVIFSA-N |
| XLogP | 1.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.11 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|