C27H47NO — CID 155445596
1-[(1S,4bR,8S,12aS)-8-(ethoxymethyl)-12a-methyl-6a-prop-2-enyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]ethanamine (PubChem CID 155445596) has the molecular formula C27H47NO and a molecular weight of 401.68 g/mol. Its IUPAC name is 1-[(1S,4bR,8S,12aS)-8-(ethoxymethyl)-12a-methyl-6a-prop-2-enyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]ethanamine.
| Compound Name | 1-[(1S,4bR,8S,12aS)-8-(ethoxymethyl)-12a-methyl-6a-prop-2-enyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]ethanamine |
|---|---|
| PubChem CID | 155445596 |
| Molecular Formula | C27H47NO |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.37 |
| IUPAC Name | 1-[(1S,4bR,8S,12aS)-8-(ethoxymethyl)-12a-methyl-6a-prop-2-enyl-1,2,3,4,4a,4b,5,6,7,8,9,10,10a,10b,11,12-hexadecahydrochrysen-1-yl]ethanamine |
| SMILES | C=CCC12CC[C@@H]3C(CC[C@@]4(C)C3CCC[C@@H]4C(C)N)C1CC[C@H](COCC)C2 |
| InChI | InChI=1S/C27H47NO/c1-5-14-27-16-13-21-22(25(27)11-10-20(17-27)18-29-6-2)12-15-26(4)23(19(3)28)8-7-9-24(21)26/h5,19-25H,1,6-18,28H2,2-4H3/t19?,20-,21+,22?,23+,24?,25?,26+,27?/m0/s1 |
| InChIKey | MAXKHESWPBJZCO-HMSKURDVSA-N |
| XLogP | 6.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|