C23H36O4 — CID 155445654
ethyl (2R,8R,15S,16S)-15-hydroxy-8,16-dimethyl-6-oxotetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate (PubChem CID 155445654) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is ethyl (2R,8R,15S,16S)-15-hydroxy-8,16-dimethyl-6-oxotetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate.
| Compound Name | ethyl (2R,8R,15S,16S)-15-hydroxy-8,16-dimethyl-6-oxotetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate |
|---|---|
| PubChem CID | 155445654 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | ethyl (2R,8R,15S,16S)-15-hydroxy-8,16-dimethyl-6-oxotetracyclo[9.7.0.02,8.012,16]octadecane-5-carboxylate |
| SMILES | CCOC(=O)C1CC[C@@H]2C3CC[C@@]4(C)C(CC[C@@H]4O)C3CC[C@]2(C)CC1=O |
| InChI | InChI=1S/C23H36O4/c1-4-27-21(26)16-5-6-17-14-10-12-23(3)18(7-8-20(23)25)15(14)9-11-22(17,2)13-19(16)24/h14-18,20,25H,4-13H2,1-3H3/t14?,15?,16?,17-,18?,20+,22-,23+/m1/s1 |
| InChIKey | JHZRAWBNBCWPOT-AIPBMJEOSA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|