C23H22N4O4 — CID 155447872
ethyl 4-amino-2-(3-cyanophenyl)-6-(2-phenylmethoxyethoxy)pyrimidine-5-carboxylate (PubChem CID 155447872) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 4-amino-2-(3-cyanophenyl)-6-(2-phenylmethoxyethoxy)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-(3-cyanophenyl)-6-(2-phenylmethoxyethoxy)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155447872 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 4-amino-2-(3-cyanophenyl)-6-(2-phenylmethoxyethoxy)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(N)nc(-c2cccc(C#N)c2)nc1OCCOCc1ccccc1 |
| InChI | InChI=1S/C23H22N4O4/c1-2-30-23(28)19-20(25)26-21(18-10-6-9-17(13-18)14-24)27-22(19)31-12-11-29-15-16-7-4-3-5-8-16/h3-10,13H,2,11-12,15H2,1H3,(H2,25,26,27) |
| InChIKey | KFPSFTQCXAVQSF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 120.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|