C19H23N5O6 — CID 155435428
4-amino-2-(3-cyanophenyl)-6-(2,3-dihydroxypropoxy)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide (PubChem CID 155435428) has the molecular formula C19H23N5O6 and a molecular weight of 417.42 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-(2,3-dihydroxypropoxy)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-(2,3-dihydroxypropoxy)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435428 |
| Molecular Formula | C19H23N5O6 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-(2,3-dihydroxypropoxy)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
| SMILES | CC(C)(O)CONC(=O)c1c(N)nc(-c2cccc(C#N)c2)nc1OCC(O)CO |
| InChI | InChI=1S/C19H23N5O6/c1-19(2,28)10-30-24-17(27)14-15(21)22-16(12-5-3-4-11(6-12)7-20)23-18(14)29-9-13(26)8-25/h3-6,13,25-26,28H,8-10H2,1-2H3,(H,24,27)(H2,21,22,23) |
| InChIKey | HAFRJCDTFCWTLJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|