C19H24N6O4 — CID 155435566
4-amino-6-[(2S)-1-aminopropan-2-yl]oxy-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide (PubChem CID 155435566) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-amino-6-[(2S)-1-aminopropan-2-yl]oxy-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-6-[(2S)-1-aminopropan-2-yl]oxy-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435566 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 4-amino-6-[(2S)-1-aminopropan-2-yl]oxy-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
| SMILES | C[C@@H](CN)Oc1nc(-c2cccc(C#N)c2)nc(N)c1C(=O)NOCC(C)(C)O |
| InChI | InChI=1S/C19H24N6O4/c1-11(8-20)29-18-14(17(26)25-28-10-19(2,3)27)15(22)23-16(24-18)13-6-4-5-12(7-13)9-21/h4-7,11,27H,8,10,20H2,1-3H3,(H,25,26)(H2,22,23,24)/t11-/m0/s1 |
| InChIKey | BYWPCYREDHGQCS-NSHDSACASA-N |
| XLogP | 0.76 |
| TPSA | 169.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|