C23H28N6O5 — CID 155435625
4-[(1S,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide (PubChem CID 155435625) has the molecular formula C23H28N6O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is 4-[(1S,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-[(1S,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435625 |
| Molecular Formula | C23H28N6O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[(1S,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
| SMILES | CC(=O)N[C@H]1CC[C@H](Oc2nc(-c3cccc(C#N)c3)nc(N)c2C(=O)NOCC(C)(C)O)C1 |
| InChI | InChI=1S/C23H28N6O5/c1-13(30)26-16-7-8-17(10-16)34-22-18(21(31)29-33-12-23(2,3)32)19(25)27-20(28-22)15-6-4-5-14(9-15)11-24/h4-6,9,16-17,32H,7-8,10,12H2,1-3H3,(H,26,30)(H,29,31)(H2,25,27,28)/t16-,17-/m0/s1 |
| InChIKey | DVRSSODHQZCCAJ-IRXDYDNUSA-N |
| XLogP | 1.47 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|