C21H27N5O5 — CID 155747485
4-amino-2-(3-cyanophenyl)-6-[(2R)-2-hydroxybutoxy]-N-(2-methoxy-2-methylpropoxy)pyrimidine-5-carboxamide (PubChem CID 155747485) has the molecular formula C21H27N5O5 and a molecular weight of 429.48 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-[(2R)-2-hydroxybutoxy]-N-(2-methoxy-2-methylpropoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-[(2R)-2-hydroxybutoxy]-N-(2-methoxy-2-methylpropoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155747485 |
| Molecular Formula | C21H27N5O5 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-[(2R)-2-hydroxybutoxy]-N-(2-methoxy-2-methylpropoxy)pyrimidine-5-carboxamide |
| SMILES | CC[C@@H](O)COc1nc(-c2cccc(C#N)c2)nc(N)c1C(=O)NOCC(C)(C)OC |
| InChI | InChI=1S/C21H27N5O5/c1-5-15(27)11-30-20-16(19(28)26-31-12-21(2,3)29-4)17(23)24-18(25-20)14-8-6-7-13(9-14)10-22/h6-9,15,27H,5,11-12H2,1-4H3,(H,26,28)(H2,23,24,25)/t15-/m1/s1 |
| InChIKey | GTGFGRZJNGRXJR-OAHLLOKOSA-N |
| XLogP | 1.83 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|