C15H14N4O4 — CID 155435448
4-amino-2-(3-cyanophenyl)-6-(2-methoxyethoxy)pyrimidine-5-carboxylic acid (PubChem CID 155435448) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-(2-methoxyethoxy)pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-(2-methoxyethoxy)pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 155435448 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-(2-methoxyethoxy)pyrimidine-5-carboxylic acid |
| SMILES | COCCOc1nc(-c2cccc(C#N)c2)nc(N)c1C(=O)O |
| InChI | InChI=1S/C15H14N4O4/c1-22-5-6-23-14-11(15(20)21)12(17)18-13(19-14)10-4-2-3-9(7-10)8-16/h2-4,7H,5-6H2,1H3,(H,20,21)(H2,17,18,19) |
| InChIKey | UGEKVXMQMBYEND-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|