C21H25F2N5O4 — CID 155747495
4-amino-2-(3-cyanophenyl)-6-cyclobutyloxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide;difluoromethane (PubChem CID 155747495) has the molecular formula C21H25F2N5O4 and a molecular weight of 449.46 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-cyclobutyloxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide;difluoromethane.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-cyclobutyloxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide;difluoromethane |
|---|---|
| PubChem CID | 155747495 |
| Molecular Formula | C21H25F2N5O4 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-cyclobutyloxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide;difluoromethane |
| SMILES | CC(C)(O)CONC(=O)c1c(N)nc(-c2cccc(C#N)c2)nc1OC1CCC1.FCF |
| InChI | InChI=1S/C20H23N5O4.CH2F2/c1-20(2,27)11-28-25-18(26)15-16(22)23-17(13-6-3-5-12(9-13)10-21)24-19(15)29-14-7-4-8-14;2-1-3/h3,5-6,9,14,27H,4,7-8,11H2,1-2H3,(H,25,26)(H2,22,23,24);1H2 |
| InChIKey | BTWVMWCPJRHMEH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|