C20H25N5O6 — CID 155435636
4-amino-2-(3-cyanophenyl)-6-[(2R,3R)-3,4-dihydroxybutan-2-yl]oxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide (PubChem CID 155435636) has the molecular formula C20H25N5O6 and a molecular weight of 431.45 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-[(2R,3R)-3,4-dihydroxybutan-2-yl]oxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-[(2R,3R)-3,4-dihydroxybutan-2-yl]oxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435636 |
| Molecular Formula | C20H25N5O6 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-[(2R,3R)-3,4-dihydroxybutan-2-yl]oxy-N-(2-hydroxy-2-methylpropoxy)pyrimidine-5-carboxamide |
| SMILES | C[C@@H](Oc1nc(-c2cccc(C#N)c2)nc(N)c1C(=O)NOCC(C)(C)O)[C@H](O)CO |
| InChI | InChI=1S/C20H25N5O6/c1-11(14(27)9-26)31-19-15(18(28)25-30-10-20(2,3)29)16(22)23-17(24-19)13-6-4-5-12(7-13)8-21/h4-7,11,14,26-27,29H,9-10H2,1-3H3,(H,25,28)(H2,22,23,24)/t11-,14-/m1/s1 |
| InChIKey | KITBDMQFGHJGLK-BXUZGUMPSA-N |
| XLogP | 0.15 |
| TPSA | 183.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|