C21H21N7O4 — CID 155435536
4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-[1-(1H-pyrazol-5-yl)ethoxy]pyrimidine-5-carboxamide (PubChem CID 155435536) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-[1-(1H-pyrazol-5-yl)ethoxy]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-[1-(1H-pyrazol-5-yl)ethoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435536 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-6-[(3S)-oxolan-3-yl]oxy-N-[1-(1H-pyrazol-5-yl)ethoxy]pyrimidine-5-carboxamide |
| SMILES | CC(ONC(=O)c1c(N)nc(-c2cccc(C#N)c2)nc1O[C@H]1CCOC1)c1ccn[nH]1 |
| InChI | InChI=1S/C21H21N7O4/c1-12(16-5-7-24-27-16)32-28-20(29)17-18(23)25-19(14-4-2-3-13(9-14)10-22)26-21(17)31-15-6-8-30-11-15/h2-5,7,9,12,15H,6,8,11H2,1H3,(H,24,27)(H,28,29)(H2,23,25,26)/t12?,15-/m0/s1 |
| InChIKey | VHSPVVZNVQEFMG-CVRLYYSRSA-N |
| XLogP | 1.91 |
| TPSA | 161.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|