C24H28N6O5 — CID 155435509
4-[(1R,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-[(1-hydroxycyclobutyl)methoxy]pyrimidine-5-carboxamide (PubChem CID 155435509) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is 4-[(1R,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-[(1-hydroxycyclobutyl)methoxy]pyrimidine-5-carboxamide.
| Compound Name | 4-[(1R,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-[(1-hydroxycyclobutyl)methoxy]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435509 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-[(1R,3S)-3-acetamidocyclopentyl]oxy-6-amino-2-(3-cyanophenyl)-N-[(1-hydroxycyclobutyl)methoxy]pyrimidine-5-carboxamide |
| SMILES | CC(=O)N[C@H]1CC[C@@H](Oc2nc(-c3cccc(C#N)c3)nc(N)c2C(=O)NOCC2(O)CCC2)C1 |
| InChI | InChI=1S/C24H28N6O5/c1-14(31)27-17-6-7-18(11-17)35-23-19(22(32)30-34-13-24(33)8-3-9-24)20(26)28-21(29-23)16-5-2-4-15(10-16)12-25/h2,4-5,10,17-18,33H,3,6-9,11,13H2,1H3,(H,27,31)(H,30,32)(H2,26,28,29)/t17-,18+/m0/s1 |
| InChIKey | BBZNQQOCDQWGBP-ZWKOTPCHSA-N |
| XLogP | 1.61 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|