C20H23N5O6 — CID 155435506
4-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)-6-[(3R,4R)-4-hydroxyoxolan-3-yl]oxypyrimidine-5-carboxamide (PubChem CID 155435506) has the molecular formula C20H23N5O6 and a molecular weight of 429.43 g/mol. Its IUPAC name is 4-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)-6-[(3R,4R)-4-hydroxyoxolan-3-yl]oxypyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)-6-[(3R,4R)-4-hydroxyoxolan-3-yl]oxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155435506 |
| Molecular Formula | C20H23N5O6 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-amino-2-(3-cyanophenyl)-N-(2-hydroxy-2-methylpropoxy)-6-[(3R,4R)-4-hydroxyoxolan-3-yl]oxypyrimidine-5-carboxamide |
| SMILES | CC(C)(O)CONC(=O)c1c(N)nc(-c2cccc(C#N)c2)nc1O[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C20H23N5O6/c1-20(2,28)10-30-25-18(27)15-16(22)23-17(12-5-3-4-11(6-12)7-21)24-19(15)31-14-9-29-8-13(14)26/h3-6,13-14,26,28H,8-10H2,1-2H3,(H,25,27)(H2,22,23,24)/t13-,14-/m1/s1 |
| InChIKey | MZRLJALTULKTAG-ZIAGYGMSSA-N |
| XLogP | 0.17 |
| TPSA | 172.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|