C16H28N2 — CID 155459600
2-[1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1-azabicyclo[2.2.2]octane (PubChem CID 155459600) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-[1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1-azabicyclo[2.2.2]octane.
| Compound Name | 2-[1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 155459600 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | 2-[1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)propyl]-1-azabicyclo[2.2.2]octane |
| SMILES | CCC(C1CC2CCN1CC2)N1CCC=C(C)C1 |
| InChI | InChI=1S/C16H28N2/c1-3-15(18-8-4-5-13(2)12-18)16-11-14-6-9-17(16)10-7-14/h5,14-16H,3-4,6-12H2,1-2H3 |
| InChIKey | BQHBJWRUYABZNO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|