C22H26ClIO4S2 — CID 155466609
2-iodosulfanylethyl 3-(5-acetyl-4-methoxythiophen-2-yl)-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate (PubChem CID 155466609) has the molecular formula C22H26ClIO4S2 and a molecular weight of 580.94 g/mol. Its IUPAC name is 2-iodosulfanylethyl 3-(5-acetyl-4-methoxythiophen-2-yl)-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate.
| Compound Name | 2-iodosulfanylethyl 3-(5-acetyl-4-methoxythiophen-2-yl)-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155466609 |
| Molecular Formula | C22H26ClIO4S2 |
| Molecular Weight | 580.94 g/mol |
| Exact Mass | 580.00 |
| IUPAC Name | 2-iodosulfanylethyl 3-(5-acetyl-4-methoxythiophen-2-yl)-3-[3-(chloromethyl)-4-methylphenyl]-2,2-dimethylpropanoate |
| SMILES | COc1cc(C(c2ccc(C)c(CCl)c2)C(C)(C)C(=O)OCCSI)sc1C(C)=O |
| InChI | InChI=1S/C22H26ClIO4S2/c1-13-6-7-15(10-16(13)12-23)19(22(3,4)21(26)28-8-9-29-24)18-11-17(27-5)20(30-18)14(2)25/h6-7,10-11,19H,8-9,12H2,1-5H3 |
| InChIKey | SAFKXGZJYDJMSX-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.94 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|