C24H21F2N3O6S2 — CID 155470312
(3R)-2-(6,7-difluoro-5,10-dihydrothieno[3,2-c][2]benzothiepin-10-yl)-11-[hydroxy(methoxy)methoxy]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 155470312) has the molecular formula C24H21F2N3O6S2 and a molecular weight of 549.58 g/mol. Its IUPAC name is (3R)-2-(6,7-difluoro-5,10-dihydrothieno[3,2-c][2]benzothiepin-10-yl)-11-[hydroxy(methoxy)methoxy]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-2-(6,7-difluoro-5,10-dihydrothieno[3,2-c][2]benzothiepin-10-yl)-11-[hydroxy(methoxy)methoxy]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 155470312 |
| Molecular Formula | C24H21F2N3O6S2 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | (3R)-2-(6,7-difluoro-5,10-dihydrothieno[3,2-c][2]benzothiepin-10-yl)-11-[hydroxy(methoxy)methoxy]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | COC(O)Oc1c2n(ccc1=O)N(C1c3ccc(F)c(F)c3CSc3ccsc31)[C@@H]1COCCN1C2=O |
| InChI | InChI=1S/C24H21F2N3O6S2/c1-33-24(32)35-21-15(30)4-6-28-20(21)23(31)27-7-8-34-10-17(27)29(28)19-12-2-3-14(25)18(26)13(12)11-37-16-5-9-36-22(16)19/h2-6,9,17,19,24,32H,7-8,10-11H2,1H3/t17-,19?,24?/m1/s1 |
| InChIKey | CRCSHDJKKRICSE-GBURSHPISA-N |
| XLogP | 2.63 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|