C42H40N4O2 — CID 155470595
[5a,9a-dihydrodibenzofuran-4-yl(amino)methoxy]-[3-[3-(2-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2,3,4-tetrahydropyrimidin-6-yl)phenyl]phenyl]methanamine (PubChem CID 155470595) has the molecular formula C42H40N4O2 and a molecular weight of 632.81 g/mol. Its IUPAC name is [5a,9a-dihydrodibenzofuran-4-yl(amino)methoxy]-[3-[3-(2-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2,3,4-tetrahydropyrimidin-6-yl)phenyl]phenyl]methanamine.
| Compound Name | [5a,9a-dihydrodibenzofuran-4-yl(amino)methoxy]-[3-[3-(2-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2,3,4-tetrahydropyrimidin-6-yl)phenyl]phenyl]methanamine |
|---|---|
| PubChem CID | 155470595 |
| Molecular Formula | C42H40N4O2 |
| Molecular Weight | 632.81 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | [5a,9a-dihydrodibenzofuran-4-yl(amino)methoxy]-[3-[3-(2-cyclohexa-1,3-dien-1-yl-4-phenyl-1,2,3,4-tetrahydropyrimidin-6-yl)phenyl]phenyl]methanamine |
| SMILES | NC(OC(N)c1cccc2c1OC1C=CC=CC21)c1cccc(-c2cccc(C3=CC(c4ccccc4)NC(C4=CC=CCC4)N3)c2)c1 |
| InChI | InChI=1S/C42H40N4O2/c43-40(48-41(44)35-22-11-21-34-33-20-7-8-23-38(33)47-39(34)35)32-19-10-17-30(25-32)29-16-9-18-31(24-29)37-26-36(27-12-3-1-4-13-27)45-42(46-37)28-14-5-2-6-15-28/h1-5,7-14,16-26,33,36,38,40-42,45-46H,6,15,43-44H2 |
| InChIKey | SRAHPSWDTXLJSO-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.81 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|