C19H26O3 — CID 15548280
(7S,8S)-7-[(E)-hept-1-enyl]-8-hydroxy-8-methyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid (PubChem CID 15548280) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (7S,8S)-7-[(E)-hept-1-enyl]-8-hydroxy-8-methyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid.
| Compound Name | (7S,8S)-7-[(E)-hept-1-enyl]-8-hydroxy-8-methyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 15548280 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (7S,8S)-7-[(E)-hept-1-enyl]-8-hydroxy-8-methyl-6,7-dihydro-5H-naphthalene-2-carboxylic acid |
| SMILES | CCCCC/C=C/[C@@H]1CCc2ccc(C(=O)O)cc2[C@@]1(C)O |
| InChI | InChI=1S/C19H26O3/c1-3-4-5-6-7-8-16-12-11-14-9-10-15(18(20)21)13-17(14)19(16,2)22/h7-10,13,16,22H,3-6,11-12H2,1-2H3,(H,20,21)/b8-7+/t16-,19+/m1/s1 |
| InChIKey | DOVVWIXVCKAWSP-WHJOBHEISA-N |
| XLogP | 4.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|