C25H39N3O4 — CID 155486015
(4R)-4-[5-(2-azidoacetyl)oxy-2,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]pentanoic acid (PubChem CID 155486015) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is (4R)-4-[5-(2-azidoacetyl)oxy-2,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]pentanoic acid.
| Compound Name | (4R)-4-[5-(2-azidoacetyl)oxy-2,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]pentanoic acid |
|---|---|
| PubChem CID | 155486015 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | (4R)-4-[5-(2-azidoacetyl)oxy-2,14-dimethyl-13-tetracyclo[8.6.0.02,7.011,14]hexadecanyl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)C1CC2C3CCC4CC(OC(=O)CN=[N+]=[N-])CCC4(C)C3CCC21C |
| InChI | InChI=1S/C25H39N3O4/c1-15(4-7-22(29)30)20-13-21-18-6-5-16-12-17(32-23(31)14-27-28-26)8-10-24(16,2)19(18)9-11-25(20,21)3/h15-21H,4-14H2,1-3H3,(H,29,30)/t15-,16?,17?,18?,19?,20?,21?,24?,25?/m1/s1 |
| InChIKey | LJUKMTYTCBIDRM-FCEHGGSWSA-N |
| XLogP | 5.98 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|