C24H21ClN4O2S — CID 155486773
3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-methoxy-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-2-ol (PubChem CID 155486773) has the molecular formula C24H21ClN4O2S and a molecular weight of 464.98 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-methoxy-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-2-ol.
| Compound Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-methoxy-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-2-ol |
|---|---|
| PubChem CID | 155486773 |
| Molecular Formula | C24H21ClN4O2S |
| Molecular Weight | 464.98 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-methoxy-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7,9-pentaen-2-ol |
| SMILES | COc1cc2c3c(c1)c(/N=N/c1nc(-c4ccc(Cl)cc4)cs1)c(O)n3C(C)(C)C=C2C |
| InChI | InChI=1S/C24H21ClN4O2S/c1-13-11-24(2,3)29-21-17(13)9-16(31-4)10-18(21)20(22(29)30)27-28-23-26-19(12-32-23)14-5-7-15(25)8-6-14/h5-12,30H,1-4H3/b28-27+ |
| InChIKey | JEPZQUYNOOHYRS-BYYHNAKLSA-N |
| XLogP | 7.70 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.98 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|