C19H15BrN4OS — CID 155518475
3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-5,7-dimethyl-1H-indol-2-ol (PubChem CID 155518475) has the molecular formula C19H15BrN4OS and a molecular weight of 427.33 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-5,7-dimethyl-1H-indol-2-ol.
| Compound Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-5,7-dimethyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 155518475 |
| Molecular Formula | C19H15BrN4OS |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-5,7-dimethyl-1H-indol-2-ol |
| SMILES | Cc1cc(C)c2[nH]c(O)c(/N=N/c3nc(-c4ccc(Br)cc4)cs3)c2c1 |
| InChI | InChI=1S/C19H15BrN4OS/c1-10-7-11(2)16-14(8-10)17(18(25)22-16)23-24-19-21-15(9-26-19)12-3-5-13(20)6-4-12/h3-9,22,25H,1-2H3/b24-23+ |
| InChIKey | DSHNZSXVZDWPNB-WCWDXBQESA-N |
| XLogP | 6.79 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|