C23H20BrFN4OS — CID 171038469
3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol (PubChem CID 171038469) has the molecular formula C23H20BrFN4OS and a molecular weight of 499.41 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol.
| Compound Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 171038469 |
| Molecular Formula | C23H20BrFN4OS |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol |
| SMILES | CC1CC(C)(C)n2c(O)c(/N=N/c3nc(-c4ccc(Br)cc4)cs3)c3cc(F)cc1c32 |
| InChI | InChI=1S/C23H20BrFN4OS/c1-12-10-23(2,3)29-20-16(12)8-15(25)9-17(20)19(21(29)30)27-28-22-26-18(11-31-22)13-4-6-14(24)7-5-13/h4-9,11-12,30H,10H2,1-3H3/b28-27+ |
| InChIKey | COGKLEPITJVZAO-BYYHNAKLSA-N |
| XLogP | 8.03 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|