C29H24ClFN4OS — CID 171038452
3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol (PubChem CID 171038452) has the molecular formula C29H24ClFN4OS and a molecular weight of 531.06 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol.
| Compound Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol |
|---|---|
| PubChem CID | 171038452 |
| Molecular Formula | C29H24ClFN4OS |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]diazenyl]-6-fluoro-9,11,11-trimethyl-9-phenyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-2-ol |
| SMILES | CC1(c2ccccc2)CC(C)(C)n2c(O)c(/N=N/c3nc(-c4ccc(Cl)cc4)cs3)c3cc(F)cc1c32 |
| InChI | InChI=1S/C29H24ClFN4OS/c1-28(2)16-29(3,18-7-5-4-6-8-18)22-14-20(31)13-21-24(26(36)35(28)25(21)22)33-34-27-32-23(15-37-27)17-9-11-19(30)12-10-17/h4-15,36H,16H2,1-3H3/b34-33+ |
| InChIKey | LFDDFSNVIRUCRW-JEIPZWNWSA-N |
| XLogP | 9.12 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|