C24H22ClN3O2S — CID 162787302
5-[9-(4-chlorophenyl)-2-hydroxy-6,9,11,11-tetramethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-2-sulfanylideneimidazol-4-one (PubChem CID 162787302) has the molecular formula C24H22ClN3O2S and a molecular weight of 451.98 g/mol. Its IUPAC name is 5-[9-(4-chlorophenyl)-2-hydroxy-6,9,11,11-tetramethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-2-sulfanylideneimidazol-4-one.
| Compound Name | 5-[9-(4-chlorophenyl)-2-hydroxy-6,9,11,11-tetramethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-2-sulfanylideneimidazol-4-one |
|---|---|
| PubChem CID | 162787302 |
| Molecular Formula | C24H22ClN3O2S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 5-[9-(4-chlorophenyl)-2-hydroxy-6,9,11,11-tetramethyl-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-3-yl]-2-sulfanylideneimidazol-4-one |
| SMILES | Cc1cc2c3c(c1)c(C1=NC(=S)NC1=O)c(O)n3C(C)(C)CC2(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClN3O2S/c1-12-9-15-17(18-20(29)27-22(31)26-18)21(30)28-19(15)16(10-12)24(4,11-23(28,2)3)13-5-7-14(25)8-6-13/h5-10,30H,11H2,1-4H3,(H,27,29,31) |
| InChIKey | ZOTLSCBYZRXOMP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|