C23H23ClN2OS2 — CID 171326113
5-[[4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinolin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 171326113) has the molecular formula C23H23ClN2OS2 and a molecular weight of 443.04 g/mol. Its IUPAC name is 5-[[4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinolin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinolin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171326113 |
| Molecular Formula | C23H23ClN2OS2 |
| Molecular Weight | 443.04 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 5-[[4-(4-chlorophenyl)-1,2,2,4-tetramethyl-3H-quinolin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1c2ccc(C=C3SC(=S)NC3=O)cc2C(C)(c2ccc(Cl)cc2)CC1(C)C |
| InChI | InChI=1S/C23H23ClN2OS2/c1-22(2)13-23(3,15-6-8-16(24)9-7-15)17-11-14(5-10-18(17)26(22)4)12-19-20(27)25-21(28)29-19/h5-12H,13H2,1-4H3,(H,25,27,28) |
| InChIKey | AMAOQLZBSLYLFF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.04 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|