C19H14ClN3O3S2 — CID 10477887
N-(4-chlorophenyl)-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxamide (PubChem CID 10477887) has the molecular formula C19H14ClN3O3S2 and a molecular weight of 431.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxamide.
| Compound Name | N-(4-chlorophenyl)-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
|---|---|
| PubChem CID | 10477887 |
| Molecular Formula | C19H14ClN3O3S2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-(4-chlorophenyl)-6-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2,3-dihydro-1,4-benzoxazine-4-carboxamide |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc2c(c1)N(C(=O)Nc1ccc(Cl)cc1)CCO2 |
| InChI | InChI=1S/C19H14ClN3O3S2/c20-12-2-4-13(5-3-12)21-18(25)23-7-8-26-15-6-1-11(9-14(15)23)10-16-17(24)22-19(27)28-16/h1-6,9-10H,7-8H2,(H,21,25)(H,22,24,27)/b16-10- |
| InChIKey | OMCSAMOTVJTYBH-YBEGLDIGSA-N |
| XLogP | 4.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|