C20H16N2O4S2 — CID 87953874
phenyl 7-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate (PubChem CID 87953874) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is phenyl 7-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate.
| Compound Name | phenyl 7-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
|---|---|
| PubChem CID | 87953874 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | phenyl 7-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-3,4-dihydro-2H-1,5-benzoxazepine-5-carboxylate |
| SMILES | O=C1NC(=S)S/C1=C/c1ccc2c(c1)N(C(=O)Oc1ccccc1)CCCO2 |
| InChI | InChI=1S/C20H16N2O4S2/c23-18-17(28-19(27)21-18)12-13-7-8-16-15(11-13)22(9-4-10-25-16)20(24)26-14-5-2-1-3-6-14/h1-3,5-8,11-12H,4,9-10H2,(H,21,23,27)/b17-12+ |
| InChIKey | OKLIXWQFVPTURO-SFQUDFHCSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|