C17H10Cl2N2O3S3 — CID 87953762
(5Z)-5-[[4-(2,5-dichlorothiophene-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87953762) has the molecular formula C17H10Cl2N2O3S3 and a molecular weight of 457.39 g/mol. Its IUPAC name is (5Z)-5-[[4-(2,5-dichlorothiophene-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[4-(2,5-dichlorothiophene-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87953762 |
| Molecular Formula | C17H10Cl2N2O3S3 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 455.92 |
| IUPAC Name | (5Z)-5-[[4-(2,5-dichlorothiophene-3-carbonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1ccc2c(c1)N(C(=O)c1cc(Cl)sc1Cl)CCO2 |
| InChI | InChI=1S/C17H10Cl2N2O3S3/c18-13-7-9(14(19)27-13)16(23)21-3-4-24-11-2-1-8(5-10(11)21)6-12-15(22)20-17(25)26-12/h1-2,5-7H,3-4H2,(H,20,22,25)/b12-6- |
| InChIKey | LFABLCZVSDLRKO-SDQBBNPISA-N |
| XLogP | 4.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|