C18H14N2O4S3 — CID 87961256
5-[[4-(benzenesulfonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 87961256) has the molecular formula C18H14N2O4S3 and a molecular weight of 418.52 g/mol. Its IUPAC name is 5-[[4-(benzenesulfonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-(benzenesulfonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 87961256 |
| Molecular Formula | C18H14N2O4S3 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 5-[[4-(benzenesulfonyl)-2,3-dihydro-1,4-benzoxazin-6-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)SC1=Cc1ccc2c(c1)N(S(=O)(=O)c1ccccc1)CCO2 |
| InChI | InChI=1S/C18H14N2O4S3/c21-17-16(26-18(25)19-17)11-12-6-7-15-14(10-12)20(8-9-24-15)27(22,23)13-4-2-1-3-5-13/h1-7,10-11H,8-9H2,(H,19,21,25) |
| InChIKey | YFPZMYHLCUIFAE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|