C11H16ClNO — CID 155487266
(4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (PubChem CID 155487266) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride.
| Compound Name | (4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 155487266 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (4S)-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| SMILES | CC1(C)C[C@H](N)c2ccccc2O1.Cl |
| InChI | InChI=1S/C11H15NO.ClH/c1-11(2)7-9(12)8-5-3-4-6-10(8)13-11;/h3-6,9H,7,12H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | OHBAWAXGKXWFAZ-FVGYRXGTSA-N |
| XLogP | 2.67 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |