C13H17NO — CID 19107088
6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine (PubChem CID 19107088) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine.
| Compound Name | 6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine |
|---|---|
| PubChem CID | 19107088 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6,6a,7,8,9,10-hexahydrobenzo[c]chromen-10a-amine |
| SMILES | NC12CCCCC1COc1ccccc12 |
| InChI | InChI=1S/C13H17NO/c14-13-8-4-3-5-10(13)9-15-12-7-2-1-6-11(12)13/h1-2,6-7,10H,3-5,8-9,14H2 |
| InChIKey | ASLGWVDYLHTOPR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |