C22H23BN2O4 — CID 155490659
3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]iminomethyl]-2H-isoquinolin-1-one (PubChem CID 155490659) has the molecular formula C22H23BN2O4 and a molecular weight of 390.25 g/mol. Its IUPAC name is 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]iminomethyl]-2H-isoquinolin-1-one.
| Compound Name | 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 155490659 |
| Molecular Formula | C22H23BN2O4 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-hydroxy-4-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]iminomethyl]-2H-isoquinolin-1-one |
| SMILES | CC1(C)OB(c2cccc(/N=C/c3c(O)[nH]c(=O)c4ccccc34)c2)OC1(C)C |
| InChI | InChI=1S/C22H23BN2O4/c1-21(2)22(3,4)29-23(28-21)14-8-7-9-15(12-14)24-13-18-16-10-5-6-11-17(16)19(26)25-20(18)27/h5-13H,1-4H3,(H2,25,26,27)/b24-13+ |
| InChIKey | NIZITWAKDDSZNM-ZMOGYAJESA-N |
| XLogP | 3.28 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|